6-Bnz-cAMP sodium salt

SMILES: O[C@H]1[C@H](N2C=3C(N=C2)=C(NC(=O)C4=CC=CC=C4)N=CN3)O[C@]5([C@]1(OP(=O)(O)OC5)[H])[H].[Na]
Formula: C17H16N5NaO7P

Description: 6-Bnz-cAMP sodium salt

Purity: 0.98
CAS#: 1135306-29-4
Molecular Weight: 456.3
Bioactivity: 6-Bnz-cAMP is a PKA-selective activator. It regulates the PKA dependent signaling pathways. The proliferative signaling pathway which activated by the 6-Bnz-cAMP involves activation of the epidermal growth factor receptor and ERK1/2. Extending the duration of PKA-dependent ERK1/2 activation and converted cAMP from a proliferative into an anti-proliferative, neurite outgrowth- promoting signal.

For research use only.